C12H18BNO3S — CID 172645600
2-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (PubChem CID 172645600) has the molecular formula C12H18BNO3S and a molecular weight of 267.16 g/mol. Its IUPAC name is 2-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole.
| Compound Name | 2-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 172645600 |
| Molecular Formula | C12H18BNO3S |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(oxetan-3-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| SMILES | CC1(C)OB(c2csc(C3COC3)n2)OC1(C)C |
| InChI | InChI=1S/C12H18BNO3S/c1-11(2)12(3,4)17-13(16-11)9-7-18-10(14-9)8-5-15-6-8/h7-8H,5-6H2,1-4H3 |
| InChIKey | FPYDOVJXIDACCW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|