C14H21BN2O4 — CID 172645352
2-(1,3-dioxan-5-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (PubChem CID 172645352) has the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is 2-(1,3-dioxan-5-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine.
| Compound Name | 2-(1,3-dioxan-5-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
|---|---|
| PubChem CID | 172645352 |
| Molecular Formula | C14H21BN2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-(1,3-dioxan-5-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| SMILES | CC1(C)OB(c2cncc(C3COCOC3)n2)OC1(C)C |
| InChI | InChI=1S/C14H21BN2O4/c1-13(2)14(3,4)21-15(20-13)12-6-16-5-11(17-12)10-7-18-9-19-8-10/h5-6,10H,7-9H2,1-4H3 |
| InChIKey | HYKIIESHULKPBP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|