C11H16BNO4S — CID 66520220
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] acetate (PubChem CID 66520220) has the molecular formula C11H16BNO4S and a molecular weight of 269.13 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] acetate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] acetate |
|---|---|
| PubChem CID | 66520220 |
| Molecular Formula | C11H16BNO4S |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl] acetate |
| SMILES | CC(=O)Oc1nc(B2OC(C)(C)C(C)(C)O2)cs1 |
| InChI | InChI=1S/C11H16BNO4S/c1-7(14)15-9-13-8(6-18-9)12-16-10(2,3)11(4,5)17-12/h6H,1-5H3 |
| InChIKey | XNAYWONDSIMLOG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|