C9H15BN2O3 — CID 170918176
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-amine (PubChem CID 170918176) has the molecular formula C9H15BN2O3 and a molecular weight of 210.04 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-amine.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 170918176 |
| Molecular Formula | C9H15BN2O3 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazol-2-amine |
| SMILES | CC1(C)OB(c2coc(N)n2)OC1(C)C |
| InChI | InChI=1S/C9H15BN2O3/c1-8(2)9(3,4)15-10(14-8)6-5-13-7(11)12-6/h5H,1-4H3,(H2,11,12) |
| InChIKey | UZVMYDZKQFXNEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|