C12H22BN3O2 — CID 172644340
N,N,1-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine (PubChem CID 172644340) has the molecular formula C12H22BN3O2 and a molecular weight of 251.14 g/mol. Its IUPAC name is N,N,1-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine.
| Compound Name | N,N,1-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 172644340 |
| Molecular Formula | C12H22BN3O2 |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | N,N,1-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazol-2-amine |
| SMILES | CN(C)c1nc(B2OC(C)(C)C(C)(C)O2)cn1C |
| InChI | InChI=1S/C12H22BN3O2/c1-11(2)12(3,4)18-13(17-11)9-8-16(7)10(14-9)15(5)6/h8H,1-7H3 |
| InChIKey | UBZGKMHUAJFNBE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|