C12H19BN2O4 — CID 153465251
2-methoxy-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one (PubChem CID 153465251) has the molecular formula C12H19BN2O4 and a molecular weight of 266.11 g/mol. Its IUPAC name is 2-methoxy-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one.
| Compound Name | 2-methoxy-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 153465251 |
| Molecular Formula | C12H19BN2O4 |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-methoxy-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-4-one |
| SMILES | COc1nc(=O)c(B2OC(C)(C)C(C)(C)O2)cn1C |
| InChI | InChI=1S/C12H19BN2O4/c1-11(2)12(3,4)19-13(18-11)8-7-15(5)10(17-6)14-9(8)16/h7H,1-6H3 |
| InChIKey | PMBFSVDVSVHBAF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|