C11H19BN2O3 — CID 138991178
5-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 138991178) has the molecular formula C11H19BN2O3 and a molecular weight of 238.10 g/mol. Its IUPAC name is 5-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 5-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 138991178 |
| Molecular Formula | C11H19BN2O3 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 5-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)nn1C |
| InChI | InChI=1S/C11H19BN2O3/c1-10(2)11(3,4)17-12(16-10)8-7-9(15-6)14(5)13-8/h7H,1-6H3 |
| InChIKey | DIVBDIPUOYIRDS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|