C18H31B2N3O5 — CID 53431576
N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide (PubChem CID 53431576) has the molecular formula C18H31B2N3O5 and a molecular weight of 391.09 g/mol. Its IUPAC name is N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide.
| Compound Name | N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 53431576 |
| Molecular Formula | C18H31B2N3O5 |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N,N-dimethyl-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
| SMILES | CN(C)C(=O)n1nc(B2OC(C)(C)C(C)(C)O2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H31B2N3O5/c1-15(2)16(3,4)26-19(25-15)12-11-13(23(21-12)14(24)22(9)10)20-27-17(5,6)18(7,8)28-20/h11H,1-10H3 |
| InChIKey | OZBIOIOXNFXEQH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|