C10H17BIN2O2P — CID 166156309
iodo-[5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane (PubChem CID 166156309) has the molecular formula C10H17BIN2O2P and a molecular weight of 365.95 g/mol. Its IUPAC name is iodo-[5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane.
| Compound Name | iodo-[5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane |
|---|---|
| PubChem CID | 166156309 |
| Molecular Formula | C10H17BIN2O2P |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | iodo-[5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)nn1PI |
| InChI | InChI=1S/C10H17BIN2O2P/c1-7-6-8(13-14(7)17-12)11-15-9(2,3)10(4,5)16-11/h6,17H,1-5H3 |
| InChIKey | LZOVHHJGOBXGGZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|