C14H18BIN3O2P — CID 177342081
[3-ethenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridin-1-yl]-iodophosphane (PubChem CID 177342081) has the molecular formula C14H18BIN3O2P and a molecular weight of 429.01 g/mol. Its IUPAC name is [3-ethenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridin-1-yl]-iodophosphane.
| Compound Name | [3-ethenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridin-1-yl]-iodophosphane |
|---|---|
| PubChem CID | 177342081 |
| Molecular Formula | C14H18BIN3O2P |
| Molecular Weight | 429.01 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | [3-ethenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridin-1-yl]-iodophosphane |
| SMILES | C=Cc1nn(PI)c2ncc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C14H18BIN3O2P/c1-6-11-10-7-9(8-17-12(10)19(18-11)22-16)15-20-13(2,3)14(4,5)21-15/h6-8,22H,1H2,2-5H3 |
| InChIKey | OLPBHFKIWXCEIG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|