C14H17BF3N3O2 — CID 167506727
3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 167506727) has the molecular formula C14H17BF3N3O2 and a molecular weight of 327.12 g/mol. Its IUPAC name is 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 167506727 |
| Molecular Formula | C14H17BF3N3O2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | Cn1c(C(F)(F)F)nc2cc(B3OC(C)(C)C(C)(C)O3)cnc21 |
| InChI | InChI=1S/C14H17BF3N3O2/c1-12(2)13(3,4)23-15(22-12)8-6-9-10(19-7-8)21(5)11(20-9)14(16,17)18/h6-7H,1-5H3 |
| InChIKey | VWLNRNXHJYXPDC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|