C20H30BN3O3 — CID 171465867
1-(oxan-2-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine (PubChem CID 171465867) has the molecular formula C20H30BN3O3 and a molecular weight of 371.29 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine.
| Compound Name | 1-(oxan-2-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 171465867 |
| Molecular Formula | C20H30BN3O3 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1-(oxan-2-yl)-3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[5,4-b]pyridine |
| SMILES | CC(C)c1nn(C2CCCCO2)c2ncc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C20H30BN3O3/c1-13(2)17-15-11-14(21-26-19(3,4)20(5,6)27-21)12-22-18(15)24(23-17)16-9-7-8-10-25-16/h11-13,16H,7-10H2,1-6H3 |
| InChIKey | RJNRTHRYFXTSMS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|