C25H30BClN2O3S — CID 169045015
5-benzylsulfanyl-7-chloro-1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 169045015) has the molecular formula C25H30BClN2O3S and a molecular weight of 484.86 g/mol. Its IUPAC name is 5-benzylsulfanyl-7-chloro-1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-benzylsulfanyl-7-chloro-1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 169045015 |
| Molecular Formula | C25H30BClN2O3S |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 5-benzylsulfanyl-7-chloro-1-(oxan-2-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC1(C)OB(c2nn(C3CCCCO3)c3c(Cl)cc(SCc4ccccc4)cc23)OC1(C)C |
| InChI | InChI=1S/C25H30BClN2O3S/c1-24(2)25(3,4)32-26(31-24)23-19-14-18(33-16-17-10-6-5-7-11-17)15-20(27)22(19)29(28-23)21-12-8-9-13-30-21/h5-7,10-11,14-15,21H,8-9,12-13,16H2,1-4H3 |
| InChIKey | WPFVHLLWMHECAJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|