C21H29BN2O3 — CID 169231053
3-methyl-1-(oxan-2-yl)-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 169231053) has the molecular formula C21H29BN2O3 and a molecular weight of 368.29 g/mol. Its IUPAC name is 3-methyl-1-(oxan-2-yl)-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-methyl-1-(oxan-2-yl)-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 169231053 |
| Molecular Formula | C21H29BN2O3 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-methyl-1-(oxan-2-yl)-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1nn(C2CCCCO2)c(-c2ccccc2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H29BN2O3/c1-15-18(22-26-20(2,3)21(4,5)27-22)19(16-11-7-6-8-12-16)24(23-15)17-13-9-10-14-25-17/h6-8,11-12,17H,9-10,13-14H2,1-5H3 |
| InChIKey | USIXANCRTKJUNL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|