C22H31BN2O3 — CID 164534746
5-cyclopropyl-6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 164534746) has the molecular formula C22H31BN2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is 5-cyclopropyl-6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-cyclopropyl-6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 164534746 |
| Molecular Formula | C22H31BN2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 5-cyclopropyl-6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cc1cc2c(cnn2C2CCCCO2)c(B2OC(C)(C)C(C)(C)O2)c1C1CC1 |
| InChI | InChI=1S/C22H31BN2O3/c1-14-12-17-16(13-24-25(17)18-8-6-7-11-26-18)20(19(14)15-9-10-15)23-27-21(2,3)22(4,5)28-23/h12-13,15,18H,6-11H2,1-5H3 |
| InChIKey | WNJADVRVDGUZPD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|