C29H47BN2O4Si — CID 171613648
tert-butyl-dimethyl-[2-[1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-5H-cyclopenta[f]indazol-5-yl]ethoxy]silane (PubChem CID 171613648) has the molecular formula C29H47BN2O4Si and a molecular weight of 526.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-5H-cyclopenta[f]indazol-5-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-5H-cyclopenta[f]indazol-5-yl]ethoxy]silane |
|---|---|
| PubChem CID | 171613648 |
| Molecular Formula | C29H47BN2O4Si |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | tert-butyl-dimethyl-[2-[1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-5H-cyclopenta[f]indazol-5-yl]ethoxy]silane |
| SMILES | CC1(C)OB(c2c3c(cc4c2cnn4C2CCCCO2)CCC3CCO[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C29H47BN2O4Si/c1-27(2,3)37(8,9)34-17-15-20-13-14-21-18-23-22(19-31-32(23)24-12-10-11-16-33-24)26(25(20)21)30-35-28(4,5)29(6,7)36-30/h18-20,24H,10-17H2,1-9H3 |
| InChIKey | ACQTUZVGKXUALQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|