C33H43BFN3O4 — CID 140865865
(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline (PubChem CID 140865865) has the molecular formula C33H43BFN3O4 and a molecular weight of 575.53 g/mol. Its IUPAC name is (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline.
| Compound Name | (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 140865865 |
| Molecular Formula | C33H43BFN3O4 |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1[C@@H]1c2ccc3c(cnn3C3CCCCO3)c2C[C@@H](C)N1CC1(F)CC1 |
| InChI | InChI=1S/C33H43BFN3O4/c1-21-17-25-23(12-13-27-26(25)19-36-38(27)29-9-7-8-16-40-29)30(37(21)20-33(35)14-15-33)24-11-10-22(18-28(24)39-6)34-41-31(2,3)32(4,5)42-34/h10-13,18-19,21,29-30H,7-9,14-17,20H2,1-6H3/t21-,29?,30+/m1/s1 |
| InChIKey | OONCHPPVRSXRRU-SKSZBTGDSA-N |
| XLogP | 5.88 |
| TPSA | 57.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|