C25H26BrF4N3O — CID 162383678
(6S,8R)-6-(4-bromo-2,6-difluorophenyl)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline (PubChem CID 162383678) has the molecular formula C25H26BrF4N3O and a molecular weight of 540.40 g/mol. Its IUPAC name is (6S,8R)-6-(4-bromo-2,6-difluorophenyl)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline.
| Compound Name | (6S,8R)-6-(4-bromo-2,6-difluorophenyl)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 162383678 |
| Molecular Formula | C25H26BrF4N3O |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | (6S,8R)-6-(4-bromo-2,6-difluorophenyl)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinoline |
| SMILES | C[C@@H]1Cc2c(ccc3c2cnn3C2CCCCO2)[C@@H](c2c(F)cc(Br)cc2F)N1CC(C)(F)F |
| InChI | InChI=1S/C25H26BrF4N3O/c1-14-9-17-16(6-7-21-18(17)12-31-33(21)22-5-3-4-8-34-22)24(32(14)13-25(2,29)30)23-19(27)10-15(26)11-20(23)28/h6-7,10-12,14,22,24H,3-5,8-9,13H2,1-2H3/t14-,22?,24+/m1/s1 |
| InChIKey | XQTUZFINRUWLKT-WZPVJNKFSA-N |
| XLogP | 6.77 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |