C31H36F5N5O3 — CID 139374296
tert-butyl 3-[3,5-difluoro-4-[3-(oxan-2-yl)-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate (PubChem CID 139374296) has the molecular formula C31H36F5N5O3 and a molecular weight of 621.65 g/mol. Its IUPAC name is tert-butyl 3-[3,5-difluoro-4-[3-(oxan-2-yl)-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3,5-difluoro-4-[3-(oxan-2-yl)-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 139374296 |
| Molecular Formula | C31H36F5N5O3 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | tert-butyl 3-[3,5-difluoro-4-[3-(oxan-2-yl)-7-(2,2,2-trifluoroethyl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]anilino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2cc(F)c(C3c4ccc5c(cnn5C5CCCCO5)c4CCN3CC(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C31H36F5N5O3/c1-30(2,3)44-29(42)40-15-19(16-40)38-18-12-23(32)27(24(33)13-18)28-21-7-8-25-22(14-37-41(25)26-6-4-5-11-43-26)20(21)9-10-39(28)17-31(34,35)36/h7-8,12-14,19,26,28,38H,4-6,9-11,15-17H2,1-3H3 |
| InChIKey | LDAOEIARENKQKQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |