C35H55BClN3O8 — CID 177330800
tert-butyl (2S,4S)-2-[4-[6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]butoxymethyl]-4-(methoxymethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 177330800) has the molecular formula C35H55BClN3O8 and a molecular weight of 692.10 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[4-[6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]butoxymethyl]-4-(methoxymethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[4-[6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]butoxymethyl]-4-(methoxymethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177330800 |
| Molecular Formula | C35H55BClN3O8 |
| Molecular Weight | 692.10 g/mol |
| Exact Mass | 691.38 |
| IUPAC Name | tert-butyl (2S,4S)-2-[4-[6-chloro-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]butoxymethyl]-4-(methoxymethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COCOC[C@H]1C[C@@H](COCCCCc2c(Cl)cc3c(cnn3C3CCCCO3)c2B2OC(C)(C)C(C)(C)O2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C35H55BClN3O8/c1-33(2,3)46-32(41)39-20-24(21-44-23-42-8)17-25(39)22-43-15-11-9-13-26-28(37)18-29-27(19-38-40(29)30-14-10-12-16-45-30)31(26)36-47-34(4,5)35(6,7)48-36/h18-19,24-25,30H,9-17,20-23H2,1-8H3/t24-,25-,30?/m0/s1 |
| InChIKey | RXKBBXHZGPSGJD-IGSIKQDTSA-N |
| XLogP | 6.27 |
| TPSA | 102.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.10 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|