C27H39BrClN3O4S — CID 171613105
tert-butyl (3R)-3-[4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butylsulfinylmethyl]piperidine-1-carboxylate (PubChem CID 171613105) has the molecular formula C27H39BrClN3O4S and a molecular weight of 617.05 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butylsulfinylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butylsulfinylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171613105 |
| Molecular Formula | C27H39BrClN3O4S |
| Molecular Weight | 617.05 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | tert-butyl (3R)-3-[4-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]butylsulfinylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CS(=O)CCCCc2c(Cl)cc3c(cnn3C3CCCCO3)c2Br)C1 |
| InChI | InChI=1S/C27H39BrClN3O4S/c1-27(2,3)36-26(33)31-12-8-9-19(17-31)18-37(34)14-7-5-10-20-22(29)15-23-21(25(20)28)16-30-32(23)24-11-4-6-13-35-24/h15-16,19,24H,4-14,17-18H2,1-3H3/t19-,24?,37?/m1/s1 |
| InChIKey | KWBJJKXUHINHDE-IXGKSBLTSA-N |
| XLogP | 6.87 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.05 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|