C18H19BrN2O — CID 171567825
(5S)-4-bromo-5-ethynyl-1-(oxan-2-yl)-5,6,7,8-tetrahydrobenzo[f]indazole (PubChem CID 171567825) has the molecular formula C18H19BrN2O and a molecular weight of 359.27 g/mol. Its IUPAC name is (5S)-4-bromo-5-ethynyl-1-(oxan-2-yl)-5,6,7,8-tetrahydrobenzo[f]indazole.
| Compound Name | (5S)-4-bromo-5-ethynyl-1-(oxan-2-yl)-5,6,7,8-tetrahydrobenzo[f]indazole |
|---|---|
| PubChem CID | 171567825 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (5S)-4-bromo-5-ethynyl-1-(oxan-2-yl)-5,6,7,8-tetrahydrobenzo[f]indazole |
| SMILES | C#C[C@@H]1CCCc2cc3c(cnn3C3CCCCO3)c(Br)c21 |
| InChI | InChI=1S/C18H19BrN2O/c1-2-12-6-5-7-13-10-15-14(18(19)17(12)13)11-20-21(15)16-8-3-4-9-22-16/h1,10-12,16H,3-9H2/t12-,16?/m1/s1 |
| InChIKey | FDBGHTWFMJCNMI-ZGTOLYCTSA-N |
| XLogP | 4.55 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|