C17H17BrF2N2O2 — CID 171567802
4-bromo-5-ethenyl-6,6-difluoro-1-(oxan-2-yl)-7H-cyclopenta[f]indazol-5-ol (PubChem CID 171567802) has the molecular formula C17H17BrF2N2O2 and a molecular weight of 399.24 g/mol. Its IUPAC name is 4-bromo-5-ethenyl-6,6-difluoro-1-(oxan-2-yl)-7H-cyclopenta[f]indazol-5-ol.
| Compound Name | 4-bromo-5-ethenyl-6,6-difluoro-1-(oxan-2-yl)-7H-cyclopenta[f]indazol-5-ol |
|---|---|
| PubChem CID | 171567802 |
| Molecular Formula | C17H17BrF2N2O2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 4-bromo-5-ethenyl-6,6-difluoro-1-(oxan-2-yl)-7H-cyclopenta[f]indazol-5-ol |
| SMILES | C=CC1(O)c2c(cc3c(cnn3C3CCCCO3)c2Br)CC1(F)F |
| InChI | InChI=1S/C17H17BrF2N2O2/c1-2-16(23)14-10(8-17(16,19)20)7-12-11(15(14)18)9-21-22(12)13-5-3-4-6-24-13/h2,7,9,13,23H,1,3-6,8H2 |
| InChIKey | HJWNLUOQHVFRRW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|