C21H28BClN2O3 — CID 154696809
6-chloro-1-(oxan-2-yl)-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]indazole (PubChem CID 154696809) has the molecular formula C21H28BClN2O3 and a molecular weight of 402.73 g/mol. Its IUPAC name is 6-chloro-1-(oxan-2-yl)-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]indazole.
| Compound Name | 6-chloro-1-(oxan-2-yl)-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]indazole |
|---|---|
| PubChem CID | 154696809 |
| Molecular Formula | C21H28BClN2O3 |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 6-chloro-1-(oxan-2-yl)-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]indazole |
| SMILES | CC1(C)OB(C2(c3cc(Cl)cc4c3cnn4C3CCCCO3)CC2)OC1(C)C |
| InChI | InChI=1S/C21H28BClN2O3/c1-19(2)20(3,4)28-22(27-19)21(8-9-21)16-11-14(23)12-17-15(16)13-24-25(17)18-7-5-6-10-26-18/h11-13,18H,5-10H2,1-4H3 |
| InChIKey | CYJHKIFMDYTVKQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|