About CID 178018564
CID 178018564 (PubChem CID 178018564) has the molecular formula C14H17BClN2O
and a molecular weight of 275.57 g/mol.
Molecular Properties
| Compound Name | CID 178018564 |
| PubChem CID | 178018564 |
| Molecular Formula | C14H17BClN2O |
| Molecular Weight | 275.57 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | — |
| SMILES | C[B]c1c(C)c(Cl)cc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C14H17BClN2O/c1-9-11(16)7-12-10(14(9)15-2)8-17-18(12)13-5-3-4-6-19-13/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | QLDZFBRXUOLKCQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178018564 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178018564?
The IUPAC name of CID 178018564 (CID 178018564) is not available.
What is the SMILES notation for CID 178018564?
The canonical SMILES for CID 178018564 is C[B]c1c(C)c(Cl)cc2c1cnn2C1CCCCO1.
What is the InChIKey of CID 178018564?
The InChIKey is QLDZFBRXUOLKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BClN2O/c1-9-11(16)7-12-10(14(9)15-2)8-17-18(12)13-5-3-4-6-19-13/h7-8,13H,3-6H2,1-2H3.
What are the key properties of CID 178018564?
CID 178018564 has a molecular weight of 275.57 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178018564 is sourced from PubChem (CID 178018564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).