C29H39BN2O6S — CID 171626712
1-[6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]propyl 4-methylbenzenesulfonate (PubChem CID 171626712) has the molecular formula C29H39BN2O6S and a molecular weight of 554.52 g/mol. Its IUPAC name is 1-[6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 1-[6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171626712 |
| Molecular Formula | C29H39BN2O6S |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 1-[6-methyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-5-yl]propyl 4-methylbenzenesulfonate |
| SMILES | CCC(OS(=O)(=O)c1ccc(C)cc1)c1c(C)cc2c(cnn2C2CCCCO2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H39BN2O6S/c1-8-24(36-39(33,34)21-14-12-19(2)13-15-21)26-20(3)17-23-22(18-31-32(23)25-11-9-10-16-35-25)27(26)30-37-28(4,5)29(6,7)38-30/h12-15,17-18,24-25H,8-11,16H2,1-7H3 |
| InChIKey | ZTAMPCSJFGQVRU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|