C9H12BrIN3P — CID 166137712
(5-bromo-3-methylpyrazolo[5,4-b]pyridin-1-yl)-iodophosphane;ethane (PubChem CID 166137712) has the molecular formula C9H12BrIN3P and a molecular weight of 400.00 g/mol. Its IUPAC name is (5-bromo-3-methylpyrazolo[5,4-b]pyridin-1-yl)-iodophosphane;ethane.
| Compound Name | (5-bromo-3-methylpyrazolo[5,4-b]pyridin-1-yl)-iodophosphane;ethane |
|---|---|
| PubChem CID | 166137712 |
| Molecular Formula | C9H12BrIN3P |
| Molecular Weight | 400.00 g/mol |
| Exact Mass | 398.90 |
| IUPAC Name | (5-bromo-3-methylpyrazolo[5,4-b]pyridin-1-yl)-iodophosphane;ethane |
| SMILES | CC.Cc1nn(PI)c2ncc(Br)cc12 |
| InChI | InChI=1S/C7H6BrIN3P.C2H6/c1-4-6-2-5(8)3-10-7(6)12(11-4)13-9;1-2/h2-3,13H,1H3;1-2H3 |
| InChIKey | HIFULSFYTWTAPY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.00 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|