C10H14BrN3 — CID 154629455
N'-(5-bromo-2-methyl-3-pyridinyl)-N-ethyl-N-methylmethanimidamide (PubChem CID 154629455) has the molecular formula C10H14BrN3 and a molecular weight of 256.15 g/mol. Its IUPAC name is N'-(5-bromo-2-methyl-3-pyridinyl)-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-(5-bromo-2-methyl-3-pyridinyl)-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154629455 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N'-(5-bromo-2-methyl-3-pyridinyl)-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)cnc1C |
| InChI | InChI=1S/C10H14BrN3/c1-4-14(3)7-13-10-5-9(11)6-12-8(10)2/h5-7H,4H2,1-3H3/b13-7+ |
| InChIKey | AYFSFLWLLLGQDD-NTUHNPAUSA-N |
| XLogP | 2.76 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|