C19H27BrN4 — CID 123383300
N'-[5-bromo-6-[(2-ethenyl-3-methylpenta-2,4-dienyl)-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 123383300) has the molecular formula C19H27BrN4 and a molecular weight of 391.36 g/mol. Its IUPAC name is N'-[5-bromo-6-[(2-ethenyl-3-methylpenta-2,4-dienyl)-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-6-[(2-ethenyl-3-methylpenta-2,4-dienyl)-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 123383300 |
| Molecular Formula | C19H27BrN4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N'-[5-bromo-6-[(2-ethenyl-3-methylpenta-2,4-dienyl)-methylamino]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | C=CC(C)=C(C=C)CN(C)c1nc(C)c(/N=C/N(C)CC)cc1Br |
| InChI | InChI=1S/C19H27BrN4/c1-8-14(4)16(9-2)12-24(7)19-17(20)11-18(15(5)22-19)21-13-23(6)10-3/h8-9,11,13H,1-2,10,12H2,3-7H3/b16-14?,21-13+ |
| InChIKey | MNPFMLBIHFDLPA-JVXPBAOTSA-N |
| XLogP | 4.89 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|