C18H25BrN4O — CID 71003676
N'-[5-bromo-6-[(3-cyanocyclohexyl)methoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71003676) has the molecular formula C18H25BrN4O and a molecular weight of 393.33 g/mol. Its IUPAC name is N'-[5-bromo-6-[(3-cyanocyclohexyl)methoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-6-[(3-cyanocyclohexyl)methoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71003676 |
| Molecular Formula | C18H25BrN4O |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N'-[5-bromo-6-[(3-cyanocyclohexyl)methoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)c(OCC2CCCC(C#N)C2)nc1C |
| InChI | InChI=1S/C18H25BrN4O/c1-4-23(3)12-21-17-9-16(19)18(22-13(17)2)24-11-15-7-5-6-14(8-15)10-20/h9,12,14-15H,4-8,11H2,1-3H3/b21-12+ |
| InChIKey | IGJBNBIRRKSEPG-CIAFOILYSA-N |
| XLogP | 4.47 |
| TPSA | 61.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|