C18H20BrF2N3O — CID 90022632
N'-[5-bromo-6-[2-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 90022632) has the molecular formula C18H20BrF2N3O and a molecular weight of 412.28 g/mol. Its IUPAC name is N'-[5-bromo-6-[2-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-6-[2-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 90022632 |
| Molecular Formula | C18H20BrF2N3O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N'-[5-bromo-6-[2-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)c(OCCc2cc(F)cc(F)c2)nc1C |
| InChI | InChI=1S/C18H20BrF2N3O/c1-4-24(3)11-22-17-10-16(19)18(23-12(17)2)25-6-5-13-7-14(20)9-15(21)8-13/h7-11H,4-6H2,1-3H3/b22-11+ |
| InChIKey | XMBSQKKAIJXBRK-SSDVNMTOSA-N |
| XLogP | 4.66 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|