C19H22BrF2N3O — CID 71003625
N'-[5-bromo-6-[1-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-methyl-N-propan-2-ylmethanimidamide (PubChem CID 71003625) has the molecular formula C19H22BrF2N3O and a molecular weight of 426.31 g/mol. Its IUPAC name is N'-[5-bromo-6-[1-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-methyl-N-propan-2-ylmethanimidamide.
| Compound Name | N'-[5-bromo-6-[1-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-methyl-N-propan-2-ylmethanimidamide |
|---|---|
| PubChem CID | 71003625 |
| Molecular Formula | C19H22BrF2N3O |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N'-[5-bromo-6-[1-(3,5-difluorophenyl)ethoxy]-2-methyl-3-pyridinyl]-N-methyl-N-propan-2-ylmethanimidamide |
| SMILES | Cc1nc(OC(C)c2cc(F)cc(F)c2)c(Br)cc1/N=C/N(C)C(C)C |
| InChI | InChI=1S/C19H22BrF2N3O/c1-11(2)25(5)10-23-18-9-17(20)19(24-12(18)3)26-13(4)14-6-15(21)8-16(22)7-14/h6-11,13H,1-5H3/b23-10+ |
| InChIKey | NYRJKCVWXAFORF-AUEPDCJTSA-N |
| XLogP | 5.57 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|