C22H31BrN4O2S — CID 146546120
N'-[5-bromo-2-methyl-6-[3-[S-methyl-N-(3-methylbutyl)sulfonimidoyl]phenoxy]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146546120) has the molecular formula C22H31BrN4O2S and a molecular weight of 495.49 g/mol. Its IUPAC name is N'-[5-bromo-2-methyl-6-[3-[S-methyl-N-(3-methylbutyl)sulfonimidoyl]phenoxy]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-2-methyl-6-[3-[S-methyl-N-(3-methylbutyl)sulfonimidoyl]phenoxy]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146546120 |
| Molecular Formula | C22H31BrN4O2S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N'-[5-bromo-2-methyl-6-[3-[S-methyl-N-(3-methylbutyl)sulfonimidoyl]phenoxy]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)c(Oc2cccc(S(C)(=O)=NCCC(C)C)c2)nc1C |
| InChI | InChI=1S/C22H31BrN4O2S/c1-7-27(5)15-24-21-14-20(23)22(26-17(21)4)29-18-9-8-10-19(13-18)30(6,28)25-12-11-16(2)3/h8-10,13-16H,7,11-12H2,1-6H3/b24-15+ |
| InChIKey | CUNDKQMIUYHZAT-BUVRLJJBSA-N |
| XLogP | 6.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|