C18H20BrIN2O — CID 68589913
N'-[4-(4-bromo-3-iodophenoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 68589913) has the molecular formula C18H20BrIN2O and a molecular weight of 487.18 g/mol. Its IUPAC name is N'-[4-(4-bromo-3-iodophenoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(4-bromo-3-iodophenoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 68589913 |
| Molecular Formula | C18H20BrIN2O |
| Molecular Weight | 487.18 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | N'-[4-(4-bromo-3-iodophenoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2ccc(Br)c(I)c2)cc1C |
| InChI | InChI=1S/C18H20BrIN2O/c1-5-22(4)11-21-17-8-13(3)18(9-12(17)2)23-14-6-7-15(19)16(20)10-14/h6-11H,5H2,1-4H3/b21-11+ |
| InChIKey | RXMKJTGFSBVWPB-SRZZPIQSSA-N |
| XLogP | 6.07 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.18 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|