C27H43N3OSi — CID 123308692
N-ethyl-N-methyl-N'-[2-methyl-6-[(2-methylphenyl)methoxy]-5-tripropylsilyl-3-pyridinyl]methanimidamide (PubChem CID 123308692) has the molecular formula C27H43N3OSi and a molecular weight of 453.75 g/mol. Its IUPAC name is N-ethyl-N-methyl-N'-[2-methyl-6-[(2-methylphenyl)methoxy]-5-tripropylsilyl-3-pyridinyl]methanimidamide.
| Compound Name | N-ethyl-N-methyl-N'-[2-methyl-6-[(2-methylphenyl)methoxy]-5-tripropylsilyl-3-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 123308692 |
| Molecular Formula | C27H43N3OSi |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | N-ethyl-N-methyl-N'-[2-methyl-6-[(2-methylphenyl)methoxy]-5-tripropylsilyl-3-pyridinyl]methanimidamide |
| SMILES | CCC[Si](CCC)(CCC)c1cc(/N=C/N(C)CC)c(C)nc1OCc1ccccc1C |
| InChI | InChI=1S/C27H43N3OSi/c1-8-16-32(17-9-2,18-10-3)26-19-25(28-21-30(7)11-4)23(6)29-27(26)31-20-24-15-13-12-14-22(24)5/h12-15,19,21H,8-11,16-18,20H2,1-7H3/b28-21+ |
| InChIKey | WTBSERGWGKSKKW-SGWCAAJKSA-N |
| XLogP | 6.77 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|