C20H26N2O — CID 139453832
N-methyl-N'-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]-N-propylmethanimidamide (PubChem CID 139453832) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is N-methyl-N'-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]-N-propylmethanimidamide.
| Compound Name | N-methyl-N'-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]-N-propylmethanimidamide |
|---|---|
| PubChem CID | 139453832 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-methyl-N'-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]-N-propylmethanimidamide |
| SMILES | CCCN(C)/C=N/c1ccc(OCc2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C20H26N2O/c1-5-12-22(4)15-21-19-10-11-20(17(3)13-19)23-14-18-9-7-6-8-16(18)2/h6-11,13,15H,5,12,14H2,1-4H3/b21-15+ |
| InChIKey | WLVYODRGUZAZGP-RCCKNPSSSA-N |
| XLogP | 4.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|