C35H36O4 — CID 162258184
3-methyl-4-[(2-methylphenyl)methoxy]benzaldehyde;(E)-4-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]but-3-en-2-one (PubChem CID 162258184) has the molecular formula C35H36O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 3-methyl-4-[(2-methylphenyl)methoxy]benzaldehyde;(E)-4-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]but-3-en-2-one.
| Compound Name | 3-methyl-4-[(2-methylphenyl)methoxy]benzaldehyde;(E)-4-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 162258184 |
| Molecular Formula | C35H36O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 3-methyl-4-[(2-methylphenyl)methoxy]benzaldehyde;(E)-4-[3-methyl-4-[(2-methylphenyl)methoxy]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(OCc2ccccc2C)c(C)c1.Cc1ccccc1COc1ccc(C=O)cc1C |
| InChI | InChI=1S/C19H20O2.C16H16O2/c1-14-6-4-5-7-18(14)13-21-19-11-10-17(12-15(19)2)9-8-16(3)20;1-12-5-3-4-6-15(12)11-18-16-8-7-14(10-17)9-13(16)2/h4-12H,13H2,1-3H3;3-10H,11H2,1-2H3/b9-8+; |
| InChIKey | ZYWJWKXDUGEWKH-HRNDJLQDSA-N |
| XLogP | 8.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|