C20H28N4 — CID 118034859
N'-[2,5-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 118034859) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is N'-[2,5-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 118034859 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N'-[2,5-dimethyl-6-[methyl-[(2-methylphenyl)methyl]amino]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)Cc2ccccc2C)nc1C |
| InChI | InChI=1S/C20H28N4/c1-7-23(5)14-21-19-12-16(3)20(22-17(19)4)24(6)13-18-11-9-8-10-15(18)2/h8-12,14H,7,13H2,1-6H3/b21-14+ |
| InChIKey | SEGLZVUKOJUPHE-KGENOOAVSA-N |
| XLogP | 4.25 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|