C19H23ClN2O2 — CID 118310253
N'-(4-benzoyl-2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide;hypochlorous acid (PubChem CID 118310253) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is N'-(4-benzoyl-2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide;hypochlorous acid.
| Compound Name | N'-(4-benzoyl-2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide;hypochlorous acid |
|---|---|
| PubChem CID | 118310253 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N'-(4-benzoyl-2,5-dimethylphenyl)-N-ethyl-N-methylmethanimidamide;hypochlorous acid |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)c2ccccc2)cc1C.OCl |
| InChI | InChI=1S/C19H22N2O.ClHO/c1-5-21(4)13-20-18-12-14(2)17(11-15(18)3)19(22)16-9-7-6-8-10-16;1-2/h6-13H,5H2,1-4H3;2H/b20-13+; |
| InChIKey | GIGIECLQZPSGFH-UNUAAEKOSA-N |
| XLogP | 4.28 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|