C19H20F2N2OS — CID 135363420
N-ethyl-N'-[5-fluoro-4-[2-(2-fluorophenyl)sulfanylacetyl]-2-methylphenyl]-N-methylmethanimidamide (PubChem CID 135363420) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is N-ethyl-N'-[5-fluoro-4-[2-(2-fluorophenyl)sulfanylacetyl]-2-methylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-fluoro-4-[2-(2-fluorophenyl)sulfanylacetyl]-2-methylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 135363420 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-ethyl-N'-[5-fluoro-4-[2-(2-fluorophenyl)sulfanylacetyl]-2-methylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)c(C(=O)CSc2ccccc2F)cc1C |
| InChI | InChI=1S/C19H20F2N2OS/c1-4-23(3)12-22-17-10-16(21)14(9-13(17)2)18(24)11-25-19-8-6-5-7-15(19)20/h5-10,12H,4,11H2,1-3H3/b22-12+ |
| InChIKey | DZEGSQRYTXIWEN-WSDLNYQXSA-N |
| XLogP | 4.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|