C21H25ClFN3O — CID 135362603
N'-[4-[2-(2-chloro-5-fluoro-N-methylanilino)acetyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 135362603) has the molecular formula C21H25ClFN3O and a molecular weight of 389.90 g/mol. Its IUPAC name is N'-[4-[2-(2-chloro-5-fluoro-N-methylanilino)acetyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[2-(2-chloro-5-fluoro-N-methylanilino)acetyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 135362603 |
| Molecular Formula | C21H25ClFN3O |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N'-[4-[2-(2-chloro-5-fluoro-N-methylanilino)acetyl]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)CN(C)c2cc(F)ccc2Cl)cc1C |
| InChI | InChI=1S/C21H25ClFN3O/c1-6-25(4)13-24-19-10-14(2)17(9-15(19)3)21(27)12-26(5)20-11-16(23)7-8-18(20)22/h7-11,13H,6,12H2,1-5H3/b24-13+ |
| InChIKey | YDOFEOCRPGKUAR-ZMOGYAJESA-N |
| XLogP | 5.03 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|