C22H28N2O — CID 163372451
N-ethyl-N'-[4-[2-(4-ethylphenyl)acetyl]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 163372451) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-ethyl-N'-[4-[2-(4-ethylphenyl)acetyl]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[2-(4-ethylphenyl)acetyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 163372451 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-ethyl-N'-[4-[2-(4-ethylphenyl)acetyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCc1ccc(CC(=O)c2cc(C)c(/N=C/N(C)CC)cc2C)cc1 |
| InChI | InChI=1S/C22H28N2O/c1-6-18-8-10-19(11-9-18)14-22(25)20-12-17(4)21(13-16(20)3)23-15-24(5)7-2/h8-13,15H,6-7,14H2,1-5H3/b23-15+ |
| InChIKey | JUAZCADLSLCZSA-HZHRSRAPSA-N |
| XLogP | 4.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|