C16H21F3N2O — CID 170655962
N'-[2,5-dimethyl-4-(4,4,4-trifluorobutanoyl)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 170655962) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-(4,4,4-trifluorobutanoyl)phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-(4,4,4-trifluorobutanoyl)phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 170655962 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-[2,5-dimethyl-4-(4,4,4-trifluorobutanoyl)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)CCC(F)(F)F)cc1C |
| InChI | InChI=1S/C16H21F3N2O/c1-5-21(4)10-20-14-9-11(2)13(8-12(14)3)15(22)6-7-16(17,18)19/h8-10H,5-7H2,1-4H3/b20-10+ |
| InChIKey | FLAFXHLKFPXLFF-KEBDBYFISA-N |
| XLogP | 4.44 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|