C23H28F3N3O — CID 163372573
4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 163372573) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 163372573 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-[[4-methyl-3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)N(C)Cc2ccc(C)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C23H28F3N3O/c1-7-28(5)14-27-21-11-16(3)19(10-17(21)4)22(30)29(6)13-18-9-8-15(2)20(12-18)23(24,25)26/h8-12,14H,7,13H2,1-6H3/b27-14+ |
| InChIKey | AHPLRONSTXCZMD-MZJWZYIUSA-N |
| XLogP | 5.51 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|