C20H24F3N3 — CID 146197787
N'-[2,5-dimethyl-4-[N-methyl-2-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197787) has the molecular formula C20H24F3N3 and a molecular weight of 363.43 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[N-methyl-2-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[N-methyl-2-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197787 |
| Molecular Formula | C20H24F3N3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N'-[2,5-dimethyl-4-[N-methyl-2-(trifluoromethyl)anilino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(N(C)c2ccccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C20H24F3N3/c1-6-25(4)13-24-17-11-15(3)19(12-14(17)2)26(5)18-10-8-7-9-16(18)20(21,22)23/h7-13H,6H2,1-5H3/b24-13+ |
| InChIKey | GCISFBSHNNZNJB-ZMOGYAJESA-N |
| XLogP | 5.70 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|