C18H22BrN3 — CID 146197869
N'-[4-(2-bromoanilino)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197869) has the molecular formula C18H22BrN3 and a molecular weight of 360.30 g/mol. Its IUPAC name is N'-[4-(2-bromoanilino)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(2-bromoanilino)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197869 |
| Molecular Formula | C18H22BrN3 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N'-[4-(2-bromoanilino)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Nc2ccccc2Br)cc1C |
| InChI | InChI=1S/C18H22BrN3/c1-5-22(4)12-20-17-10-14(3)18(11-13(17)2)21-16-9-7-6-8-15(16)19/h6-12,21H,5H2,1-4H3/b20-12+ |
| InChIKey | OXQVKYUYVJZIHS-UDWIEESQSA-N |
| XLogP | 5.42 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|