C18H22ClN3O — CID 146197725
N'-[5-chloro-4-(4-methoxyanilino)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197725) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is N'-[5-chloro-4-(4-methoxyanilino)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-chloro-4-(4-methoxyanilino)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197725 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N'-[5-chloro-4-(4-methoxyanilino)-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Nc2ccc(OC)cc2)cc1C |
| InChI | InChI=1S/C18H22ClN3O/c1-5-22(3)12-20-17-11-16(19)18(10-13(17)2)21-14-6-8-15(23-4)9-7-14/h6-12,21H,5H2,1-4H3/b20-12+ |
| InChIKey | MMFMMBMSQOIACF-UDWIEESQSA-N |
| XLogP | 5.01 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|