C19H24FN3O2 — CID 154647748
N-ethyl-N'-[3-(3-fluoro-4-methoxyanilino)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide (PubChem CID 154647748) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is N-ethyl-N'-[3-(3-fluoro-4-methoxyanilino)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[3-(3-fluoro-4-methoxyanilino)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647748 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-ethyl-N'-[3-(3-fluoro-4-methoxyanilino)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)cc(Nc2ccc(OC)c(F)c2)c1C |
| InChI | InChI=1S/C19H24FN3O2/c1-6-23(3)12-21-17-10-15(24-4)11-18(13(17)2)22-14-7-8-19(25-5)16(20)9-14/h7-12,22H,6H2,1-5H3/b21-12+ |
| InChIKey | FHKNDJQBFOFIPI-CIAFOILYSA-N |
| XLogP | 4.51 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|