C18H21ClFN3O — CID 142322849
N'-[2-chloro-4-(4-fluoro-3-methoxyanilino)-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 142322849) has the molecular formula C18H21ClFN3O and a molecular weight of 349.84 g/mol. Its IUPAC name is N'-[2-chloro-4-(4-fluoro-3-methoxyanilino)-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-(4-fluoro-3-methoxyanilino)-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 142322849 |
| Molecular Formula | C18H21ClFN3O |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N'-[2-chloro-4-(4-fluoro-3-methoxyanilino)-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Nc2ccc(F)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C18H21ClFN3O/c1-5-23(3)11-21-17-8-12(2)16(10-14(17)19)22-13-6-7-15(20)18(9-13)24-4/h6-11,22H,5H2,1-4H3/b21-11+ |
| InChIKey | MHXKRJQSWJURLF-SRZZPIQSSA-N |
| XLogP | 5.15 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|