C20H23Cl2N3O2S — CID 146197939
5-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-2-propan-2-ylsulfanylbenzoic acid (PubChem CID 146197939) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is 5-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-2-propan-2-ylsulfanylbenzoic acid.
| Compound Name | 5-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-2-propan-2-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 146197939 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 5-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-2-propan-2-ylsulfanylbenzoic acid |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Nc2ccc(SC(C)C)c(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O2S/c1-5-25(4)11-23-17-9-16(22)18(10-15(17)21)24-13-6-7-19(28-12(2)3)14(8-13)20(26)27/h6-12,24H,5H2,1-4H3,(H,26,27)/b23-11+ |
| InChIKey | GFQNKMBQRVLFAH-FOKLQQMPSA-N |
| XLogP | 6.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|